LBF12110BC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7106 |
| LipidMaps | LMFA01020138 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF12110BC01.mol |
| |
| Structural Information | |
| Systematic Name | 4-Heptyl-2-Methyl-2-Undecenoic Acid |
| Common Name | |
| Symbol | |
| Formula | C19H36O2 |
| Exact Mass | 296.271530396 |
| Average Mass | 296.48794000000004 |
| SMILES | CCCCCCCC(CCCCCCC)C=C(C)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 183 - 184°C/0.5mmHg <<7102>> |
| Density | |
| Optical Rotation | h25/D = 1.4643 <<7102>> |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax 219nm (emax 13,800) <<7102>> |
| IR Spectra | C=CH: 9.91, 12.42, 13.29, 15.01m <<7102>> |
| NMR Spectra | |
| Chromatograms | |
