LBF10105BC01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7110 | |LipidBank=DFA7110 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA7110 |
LipidMaps | LMFA01020142 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF10105BC01.mol |
Structural Information | |
---|---|
Systematic Name | 6-Isopentyl-9-Methyl-5-Decenoic Acid |
Common Name | |
Symbol | |
Formula | C16H30O2 |
Exact Mass | 254.22458020399998 |
Average Mass | 254.4082 |
SMILES | CC(C)CCC=C(CCCC(O)=O)CCC(C)C |
Physicochemical Information | |
Melting Point | |
Boiling Point | 142 - 145°C/0.2mmHg <<7110>> |
Density | |
Optical Rotation | h20/D = 1.4562 <<7110>> |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |