LBF10000BC04
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7141 |
| LipidMaps | LMFA01020173 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF10000BC04.mol |
| |
| Structural Information | |
| Systematic Name | 2-Ethyl-2-Butyl Decanoic Acid |
| Common Name | |
| Symbol | |
| Formula | C16H32O2 |
| Exact Mass | 256.240230268 |
| Average Mass | 256.42408 |
| SMILES | CCCCCCCCC(CC)(CCCC)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 138-139°C/0.4mmHg <<7123>> |
| Density | |
| Optical Rotation | h25/D=1.4500<<7123>> |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
