Honokiol
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=3',5-Di-2-propen-1-yl-[1,1'-biphenyl]-2,4'-diol |Common Name=&&3',5-di-2-Propenyl-[1,1'-biphenyl]-2,4'-diol&&3',5-Diallyl-2,4'-biphenyldio...) |
Revision as of 09:25, 10 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 35354-74-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Honokiol.mol |
| 3',5-di-2-Propenyl-[1,1'-biphenyl]-2,4'-diol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3',5-Di-2-propen-1-yl-[1,1'-biphenyl]-2,4'-diol |
| Common Name |
|
| Symbol | |
| Formula | C18H18O2 |
| Exact Mass | 266.13067982 |
| Average Mass | 266.33432 |
| SMILES | C=CCc(c2)cc(c(O)c2)c(c1)cc(CC=C)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
