Gomisin A
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(6S,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol |Common Name=&&5,6,7,8-...) |
Revision as of 12:35, 10 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 58546-54-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Gomisin A.mol |
5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol stereoisomer; | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (6S,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol |
Common Name |
|
Symbol | |
Formula | C23H28O7 |
Exact Mass | 416.18350325 |
Average Mass | 416.46422000000007 |
SMILES | COc(c4)c(OC)c(OC)c(c43)c(c(CC(C)C(C)(O)C3)1)c(OC)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |