Gingerol
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(5S)-, 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-, 3-Decanone |Common Name=&&(S)-, 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-, 3-Decanone&&(S)...) |
|||
| (One intermediate revision by one user not shown) | |||
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(5S)- | + | |SysName=(5S)-5-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-decanone |
| − | |Common Name=&&(S)- | + | |Common Name=&&[6]-Gingerol&&(S)-5-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-decanone&&(S)-(+)-5-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-decanone&&(+)-5-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-decanone&&(+)-[6]-Gingerol&&(S)-(+)-[6]Gingerol&&(S)-[6]Gingerol&& |
|CAS=23513-14-6 | |CAS=23513-14-6 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 14:37, 18 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 23513-14-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Gingerol.mol |
| [6]-Gingerol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (5S)-5-Hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-decanone |
| Common Name |
|
| Symbol | |
| Formula | C17H26O4 |
| Exact Mass | 294.18310931999997 |
| Average Mass | 294.38593999999995 |
| SMILES | CCCCCC(O)CC(=O)CCc(c1)cc(OC)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
