FLNE29NS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=6-Hydroxy-7-methoxyneoflavene | |SysName=6-Hydroxy-7-methoxyneoflavene | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNE Neoflavene : FLNE29 6,7,(3),(5)-Hydroxyneoflavene and O-methyl derivatives (0 pages) : FLNE29NS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 32066-31-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNE29NS0001.mol |
| Dalbergichromene | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6-Hydroxy-7-methoxyneoflavene |
| Common Name |
|
| Symbol | |
| Formula | C16H14O3 |
| Exact Mass | 254.094294314 |
| Average Mass | 254.28056 |
| SMILES | COc(c3)c(O)cc(c23)C(=CCO2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
