FLNC28NS0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName= (R) -5,2'-Dihydroxy-2,4-dimethoxydalbergiquinol |
| − | |Common Name=&&Latifolin&&(R)-5,2'-Dihydroxy-2,4-dimethoxydalbergiquinol&& | + | |Common Name=&&Latifolin&& (R) -5,2'-Dihydroxy-2,4-dimethoxydalbergiquinol&& |
|CAS=10154-42-4 | |CAS=10154-42-4 | ||
|KNApSAcK=C00010258 | |KNApSAcK=C00010258 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNC Dalbergiquinol : FLNC28 2,4,5,2',(3'),(5'),(6')-Hydroxydalbergiquinol and O-methyl derivatives (1 pages) : FLNC28NS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 10154-42-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNC28NS0001.mol |
| Latifolin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) -5,2'-Dihydroxy-2,4-dimethoxydalbergiquinol |
| Common Name |
|
| Symbol | |
| Formula | C17H18O4 |
| Exact Mass | 286.120509064 |
| Average Mass | 286.32241999999997 |
| SMILES | COc(c2)c(O)cc(c(OC)2)[C@]([H])(C=C)c(c1)c(O)ccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
