FLIH3LNF0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=9-Methoxy-6-(2-methoxy-4,5-methylenedioxyphenyl)-7H-furo[3,2-g][1]benzopyran-7-one | + | |SysName=9-Methoxy-6- (2-methoxy-4,5-methylenedioxyphenyl) -7H-furo [ 3,2-g ] [ 1 ] benzopyran-7-one |
| − | |Common Name=&&Neofolin&&9-Methoxy-6-(2-methoxy-4,5-methylenedioxyphenyl)-7H-furo[3,2-g][1]benzopyran-7-one&& | + | |Common Name=&&Neofolin&&9-Methoxy-6- (2-methoxy-4,5-methylenedioxyphenyl) -7H-furo [ 3,2-g ] [ 1 ] benzopyran-7-one&& |
|CAS=10338-02-0 | |CAS=10338-02-0 | ||
|KNApSAcK=C00009784 | |KNApSAcK=C00009784 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 10338-02-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIH3LNF0001.mol |
| Neofolin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9-Methoxy-6- (2-methoxy-4,5-methylenedioxyphenyl) -7H-furo [ 3,2-g ] [ 1 ] benzopyran-7-one |
| Common Name |
|
| Symbol | |
| Formula | C20H14O7 |
| Exact Mass | 366.073952802 |
| Average Mass | 366.32096 |
| SMILES | COc(c2)c(C(C(=O)3)=Cc(c4)c(c(c(o5)c(cc5)4)OC)O3)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
