FLIFALNP0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=(7aS,13aS)-13,13a-Dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-bis[1]benzopyrano[3,4-b:6',5'-e]pyran-7(7aH)-one |
|Common Name=&&Toxicarol&&alpha-Toxicarol&&Toxicarin&& | |Common Name=&&Toxicarol&&alpha-Toxicarol&&Toxicarin&& | ||
|CAS=82-09-7 | |CAS=82-09-7 | ||
|KNApSAcK=C00002580 | |KNApSAcK=C00002580 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 82-09-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIFALNP0001.mol |
| Toxicarol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (7aS,13aS)-13,13a-Dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-bis[1]benzopyrano[3,4-b:6',5'-e]pyran-7(7aH)-one |
| Common Name |
|
| Symbol | |
| Formula | C23H22O7 |
| Exact Mass | 410.136553058 |
| Average Mass | 410.41658000000007 |
| SMILES | [H][C@@]([C@]4([H])3)(c(c5)c(cc(c5OC)OC)OC4)C(=O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
