FLIF1LNF0005
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 22256-05-9 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIF1LNF0005.mol |
Isomillettone | |
---|---|
Structural Information | |
Systematic Name | (2R)-2,3,4abeta,11bbeta-Tetrahydro-2-(1-methylethenyl)[1,3]dioxolo[6,7][1]benzopyrano[3,4-b]furo[2,3-h][1]benzopyran-12(5H)-one |
Common Name |
|
Symbol | |
Formula | C22H18O6 |
Exact Mass | 378.110338308 |
Average Mass | 378.37472 |
SMILES | c(c62)(C(C5CO6)C(=O)c(c4O5)ccc(c43)OC(C(C)=C)C3)cc |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|