FLIF1LGF0005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2-Hydroxy-2-(1,2,6a,12a-tetrahydro-8,9-dimethoxy-12H-[1]benzopyrano[4,3-b]furo[3,2-f][1,4]benzodioxin-2-yl)propyl 6-O-alpha-L-arabinopyranosyl-beta-D-glucopyranoside |
|Common Name=&&Amorphigenol O-vicianoside&&Amorphol&& | |Common Name=&&Amorphigenol O-vicianoside&&Amorphol&& | ||
|CAS=53947-91-4 | |CAS=53947-91-4 | ||
|KNApSAcK=C00010180 | |KNApSAcK=C00010180 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 53947-91-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIF1LGF0005.mol |
Amorphigenol O-vicianoside | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C34H42O17 |
Exact Mass | 722.242199918 |
Average Mass | 722.6870799999999 |
SMILES | O(C75)c(c(C(=O)C(c(c(OC7)6)cc(c(OC)c6)OC)5)1)c(C2) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|