FLIDWXNS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Bryacarpene 5 | + | |SysName=Bryacarpene 5 |
|Common Name=&&Bryacarpene 5&&3,9,10-Trimethoxypterocarpene&& | |Common Name=&&Bryacarpene 5&&3,9,10-Trimethoxypterocarpene&& | ||
|CAS=55306-18-8 | |CAS=55306-18-8 | ||
|KNApSAcK=C00009696 | |KNApSAcK=C00009696 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 55306-18-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIDWXNS0004.mol |
| Bryacarpene 5 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Bryacarpene 5 |
| Common Name |
|
| Symbol | |
| Formula | C18H16O5 |
| Exact Mass | 312.099773622 |
| Average Mass | 312.31664 |
| SMILES | c(c1OC)(OC)ccc(c24)c(oc(c(c3OC4)ccc(OC)c3)2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
