FLIDWXNS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3-Methoxy-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran | + | |SysName=3-Methoxy-6H- [ 1,3 ] dioxolo [ 5,6 ] benzofuro [ 3,2-c ] [ 1 ] benzopyran |
| − | |Common Name=&&6a,11a-Dehydropterocarpin&&Anhydropisatin&&Flemichapparin B&&3-Methoxy-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran&& | + | |Common Name=&&6a,11a-Dehydropterocarpin&&Anhydropisatin&&Flemichapparin B&&3-Methoxy-6H- [ 1,3 ] dioxolo [ 5,6 ] benzofuro [ 3,2-c ] [ 1 ] benzopyran&& |
|CAS=3187-53-9 | |CAS=3187-53-9 | ||
|KNApSAcK=C00009695 | |KNApSAcK=C00009695 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3187-53-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIDWXNS0003.mol |
| 6a,11a-Dehydropterocarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Methoxy-6H- [ 1,3 ] dioxolo [ 5,6 ] benzofuro [ 3,2-c ] [ 1 ] benzopyran |
| Common Name |
|
| Symbol | |
| Formula | C17H12O5 |
| Exact Mass | 296.068473494 |
| Average Mass | 296.27418 |
| SMILES | COc(c5)cc(O4)c(c5)c(o1)c(C4)c(c2)c(cc(O3)c(OC3)2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
