FLID1CNS0008
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(6aR,11aR)-8-Hydroxy-3,9-dimethoxypterocarpan | + | |SysName= (6aR,11aR) -8-Hydroxy-3,9-dimethoxypterocarpan |
| − | |Common Name=&&(6aR,11aR)-8-Hydroxy-3,9-dimethoxypterocarpan&& | + | |Common Name=&& (6aR,11aR) -8-Hydroxy-3,9-dimethoxypterocarpan&& |
|CAS=108335-31-5 | |CAS=108335-31-5 | ||
|KNApSAcK=C00010007 | |KNApSAcK=C00010007 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID1C 3,8,9-Trihydroxypterocarpane or 3,9,10-Trihydroxypterocarpane and O-methyl derivatives (25 pages) : FLID1CNS Simple substitution (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 108335-31-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1CNS0008.mol |
| (6aR,11aR) -8-Hydroxy-3,9-dimethoxypterocarpan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6aR,11aR) -8-Hydroxy-3,9-dimethoxypterocarpan |
| Common Name |
|
| Symbol | |
| Formula | C17H16O5 |
| Exact Mass | 300.099773622 |
| Average Mass | 300.30593999999996 |
| SMILES | COc(c4)cc(O3)c(c4)C(O1)C(C3)c(c2)c(cc(OC)c(O)2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
