FLID1ANS0004
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=(6aR)-6aalpha,11aalpha-Dihydro-3,9-dimethoxy-6H-benzofuro[3,2-c][1]benzopyran |
|Common Name=&&(-)-Homopterocarpin&&Baphinitone&&3,9-Dimethoxypterocarpan&& | |Common Name=&&(-)-Homopterocarpin&&Baphinitone&&3,9-Dimethoxypterocarpan&& | ||
|CAS=606-91-7 | |CAS=606-91-7 | ||
|KNApSAcK=C00009613 | |KNApSAcK=C00009613 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 606-91-7 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLID1ANS0004.mol |
(-)-Homopterocarpin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C17H16O4 |
Exact Mass | 284.104859 |
Average Mass | 284.30654 |
SMILES | COc(c4)cc(O3)c(c4)C(O1)C(C3)c(c2)c(cc(OC)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|