FLICWXNS0005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=7,3'-Dihydroxy-2',4'-dimethoxyisoflavene |
|Common Name=&&2'-O-Methylsepiol&&7,3'-Dihydroxy-2',4'-dimethoxyisoflavene&& | |Common Name=&&2'-O-Methylsepiol&&7,3'-Dihydroxy-2',4'-dimethoxyisoflavene&& | ||
|CAS=62078-14-2 | |CAS=62078-14-2 | ||
|KNApSAcK=C00009752 | |KNApSAcK=C00009752 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 62078-14-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLICWXNS0005.mol |
2'-O-Methylsepiol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C17H16O5 |
Exact Mass | 300.099773622 |
Average Mass | 300.30593999999996 |
SMILES | COc(c3)c(O)c(OC)c(c3)C(C1)=Cc(c2)c(cc(O)c2)O1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|