FLIC4LNS0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=6,2'-Dihydroxy-7,8,3',4'-tetramethoxyisoflavan |
|Common Name=&&Machaerol B&&6,2'-Dihydroxy-7,8,3',4'-tetramethoxyisoflavan&& | |Common Name=&&Machaerol B&&6,2'-Dihydroxy-7,8,3',4'-tetramethoxyisoflavan&& | ||
|CAS=51798-42-6 | |CAS=51798-42-6 | ||
|KNApSAcK=C00009724 | |KNApSAcK=C00009724 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 51798-42-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIC4LNS0002.mol |
Machaerol B | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 6,2'-Dihydroxy-7,8,3',4'-tetramethoxyisoflavan |
Common Name |
|
Symbol | |
Formula | C19H22O7 |
Exact Mass | 362.136553058 |
Average Mass | 362.37378 |
SMILES | c(c3OC)(O)cc(c(c3OC)1)CC(c(c2O)ccc(c2OC)OC)CO1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|