FLIC1LNP0012
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3-[3,4-Dihydro-8-methyl-8-(4-methyl-3-pentenyl)-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]-6-methoxy-1,2-benzenediol | |SysName=3-[3,4-Dihydro-8-methyl-8-(4-methyl-3-pentenyl)-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]-6-methoxy-1,2-benzenediol | ||
| − | |Common Name=&&Nitidulin&& | + | |Common Name=&&Nitidulin&&3-[3,4-Dihydro-8-methyl-8-(4-methyl-3-pentenyl)-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]-6-methoxy-1,2-benzenediol&& |
|CAS=66446-87-5 | |CAS=66446-87-5 | ||
|KNApSAcK=C00009738 | |KNApSAcK=C00009738 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 66446-87-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIC1LNP0012.mol |
| Nitidulin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-[3,4-Dihydro-8-methyl-8-(4-methyl-3-pentenyl)-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]-6-methoxy-1,2-benzenediol |
| Common Name |
|
| Symbol | |
| Formula | C26H30O5 |
| Exact Mass | 422.20932407 |
| Average Mass | 422.5134 |
| SMILES | O(c42)CC(Cc2ccc(c43)OC(C)(CCC=C(C)C)C=C3)c(c(O)1)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
