FLIAEANS0010
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5-Methoxyafrormosin | + | |SysName=5-Methoxyafrormosin |
|Common Name=&&5-Methoxyafrormosin&&7-Hydroxy-5,6,4'-trimethoxyisoflavone&& | |Common Name=&&5-Methoxyafrormosin&&7-Hydroxy-5,6,4'-trimethoxyisoflavone&& | ||
|CAS=53505-61-6 | |CAS=53505-61-6 | ||
|KNApSAcK=C00009470 | |KNApSAcK=C00009470 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 53505-61-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAEANS0010.mol |
| 5-Methoxyafrormosin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Methoxyafrormosin |
| Common Name |
|
| Symbol | |
| Formula | C18H16O6 |
| Exact Mass | 328.094688244 |
| Average Mass | 328.31604 |
| SMILES | c(c3OC)(O)cc(c1c3OC)OC=C(c(c2)ccc(OC)c2)C1=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
