FLIAEAGS0005
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,4'-Dihydroxy-6,7-dimethoxyisoflavone 4'-O-glucoside | |SysName=5,4'-Dihydroxy-6,7-dimethoxyisoflavone 4'-O-glucoside | ||
| − | |Common Name=&&7-O-Methyltectorigenin 4'-O-glucoside&& | + | |Common Name=&&7-O-Methyltectorigenin 4'-O-glucoside&&5,4'-Dihydroxy-6,7-dimethoxyisoflavone 4'-O-glucoside&& |
|CAS=19316-92-8 | |CAS=19316-92-8 | ||
|KNApSAcK=C00010126 | |KNApSAcK=C00010126 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 19316-92-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAEAGS0005.mol |
| 7-O-Methyltectorigenin 4'-O-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,4'-Dihydroxy-6,7-dimethoxyisoflavone 4'-O-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C23H24O11 |
| Exact Mass | 476.13186161 |
| Average Mass | 476.43006 |
| SMILES | c(c3OC(C(O)4)OC(CO)C(O)C4O)cc(cc3)C(C1=O)=COc(c2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
