FLIAALNS0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2'-Methoxybiochanin A | + | |SysName=2'-Methoxybiochanin A |
|Common Name=&&2'-Methoxybiochanin A&&5,7-Dihydroxy-2',4'-dimethoxyisoflavone&& | |Common Name=&&2'-Methoxybiochanin A&&5,7-Dihydroxy-2',4'-dimethoxyisoflavone&& | ||
|CAS=61243-75-2 | |CAS=61243-75-2 | ||
|KNApSAcK=C00009462 | |KNApSAcK=C00009462 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 61243-75-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAALNS0004.mol |
| 2'-Methoxybiochanin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2'-Methoxybiochanin A |
| Common Name |
|
| Symbol | |
| Formula | C17H14O6 |
| Exact Mass | 314.07903818 |
| Average Mass | 314.28945999999996 |
| SMILES | COc(c3)cc(OC)c(c3)C(=C1)C(=O)c(c(O)2)c(cc(O)c2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
