FLIG1LNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIG Coumaranochromone : FLIG1L 5,7,(3'),4',(5'),(6')-Hydroxycoumaronochromone and O-methyl derivatives (11 pages) : FLIG1LNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 98094-87-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIG1LNS0001.mol |
| Lupinalbin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1,3,8-Trihydroxy-11H-benzofuro [ 2,3-b ] [ 1 ] benzopyran-11-one |
| Common Name |
|
| Symbol | |
| Formula | C15H8O6 |
| Exact Mass | 284.032087988 |
| Average Mass | 284.22042 |
| SMILES | Oc(c4)cc(o1)c(c4)c(C(=O)2)c1Oc(c3)c(c(O)cc(O)3)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
