LBF20406AM05
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7021 | |LipidBank=XPR7021 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7021 |
| LipidMaps | LMFA08020007 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM05.mol |
| |
| Structural Information | |
| Systematic Name | N-methyl arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C21H35NO |
| Exact Mass | 317.271864747 |
| Average Mass | 317.50873999999993 |
| SMILES | C(CC=CCC=CCC=CCC=CCCCC(NC)=O)CCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.80 (br s, lH), 5.30-5.40 (m, 8H), 2.78-2.85 (m, 9H), 2.03-2.19 (m, 6H), 1.66-1.76 (m, 2H), 1.25-1.34 (m, 6H), 0.88 (t, J=9Hz, 3H) <<7001>> |
| Chromatograms | |
