BMCCCC--k021
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C06659 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCCC--k021.mol |
| Dihydroclavaminic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Dihydro-clavaminic acid |
| Common Name |
|
| Symbol | |
| Formula | C8H12N2O4 |
| Exact Mass | 200.0797 |
| Average Mass | 200.1919 |
| SMILES | NCC[C@@H](O1)[C@@H](C(O)=O)N(C(=O)2)[C@H](C2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
