LBF20206HO01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8114 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20206HO01.mol |
| |
| Structural Information | |
| Systematic Name | 11R-hydroxy-12E,14Z-eicosadienoic acid |
| Common Name | |
| Symbol | |
| Formula | C20H36O3 |
| Exact Mass | 324.266445018 |
| Average Mass | 324.49804 |
| SMILES | C(CC=CC=C[C@@H](CCCCCCCCCC(O)=O)O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax: 234nm e: 23,000 |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
