LBF16000BC11
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7143 |
| LipidMaps | LMFA01020175 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF16000BC11.mol |
| |
| Structural Information | |
| Systematic Name | 11,15-Dimethyl Hexadecanoic Acid |
| Common Name | |
| Symbol | |
| Formula | C18H36O2 |
| Exact Mass | 284.271530396 |
| Average Mass | 284.47724 |
| SMILES | CC(C)CCCC(C)CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 165-172°C/0.5Torr |
| Density | |
| Optical Rotation | h20/D=1.4480 |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
