<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AFL7AACGL0133</id>
		<title>Mol:FL7AACGL0133 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AFL7AACGL0133"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0133&amp;action=history"/>
		<updated>2026-05-30T12:31:24Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0133&amp;diff=304056&amp;oldid=prev</id>
		<title>Editor at 07:23, 5 December 2012</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0133&amp;diff=304056&amp;oldid=prev"/>
				<updated>2012-12-05T07:23:40Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 07:23, 5 December 2012&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 1:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 1:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;FL7AACGL0133.mol &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;&amp;#160; ChemDraw12051216113D &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;Copyright: ARM project http://www.metabolome.jp/ &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 35 39&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0999 V2000 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 35 39&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0999 V2000 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; &amp;#160; 0.0330&amp;#160;  -0.8250&amp;#160;  -2.5960 O&amp;#160;  0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; &amp;#160; 0.0330&amp;#160;  -0.8250&amp;#160;  -2.5960 O&amp;#160;  0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 78:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 78:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 1 28&amp;#160; 1&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 1 28&amp;#160; 1&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; CHG&amp;#160; 1&amp;#160;  8&amp;#160;  1 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; CHG&amp;#160; 1&amp;#160;  8&amp;#160;  1 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;del class=&quot;diffchange diffchange-inline&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;9 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	FL7AACGL0133 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	FL7AACGL0133 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;KNApSAcK_ID	 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;NAME	Pyranocyanin B &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;CAS_RN	294845-03-7 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C24H23O11 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C24H23O11 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	487.124036578 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	487.124036578 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0133&amp;diff=304053&amp;oldid=prev</id>
		<title>Editor: Created page with &quot;FL7AACGL0133.mol    ChemDraw12051216113D     35 39  0  0  0  0  0  0  0  0999 V2000      0.0330   -0.8250   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0     -0.6815   -0.412...&quot;</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0133&amp;diff=304053&amp;oldid=prev"/>
				<updated>2012-12-05T07:22:50Z</updated>
		
		<summary type="html">&lt;p&gt;Created page with &amp;quot;FL7AACGL0133.mol    ChemDraw12051216113D     35 39  0  0  0  0  0  0  0  0999 V2000      0.0330   -0.8250   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0     -0.6815   -0.412...&amp;quot;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;FL7AACGL0133.mol &lt;br /&gt;
  ChemDraw12051216113D &lt;br /&gt;
 &lt;br /&gt;
 35 39  0  0  0  0  0  0  0  0999 V2000 &lt;br /&gt;
    0.0330   -0.8250   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6815   -0.4125   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.3960   -0.8251   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6815    0.4126   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1105   -0.4124   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.3960   -1.6501   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0331    0.8252   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.3960    0.8251   -2.5960 O   0  3  0  0  0  5  0  0  0  0  0  0 &lt;br /&gt;
   -2.1105    0.4127   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8250   -0.8250   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1104   -2.0626   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0330    1.6501   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7475    0.4127   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8250    0.8252   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8250   -1.6500   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5395   -0.4125   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1104   -2.8876   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7475    2.0626   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4619    0.8251   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5395    0.4127   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4619    1.6502   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7475    2.8876   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2539    0.8252   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.1764    2.0627   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.2539   -1.6263   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.7444   -1.0965    1.0460 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.8793   -0.5140    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4929   -1.1833    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.2358   -0.9709    2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9835   -1.1833    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.3700   -0.5140    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.6269   -0.7263    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.1184   -0.5327    2.1664 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9328   -0.1964    2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.1638   -0.7267    2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0 &lt;br /&gt;
  2  3  2  0 &lt;br /&gt;
  2  4  1  0 &lt;br /&gt;
  3  5  1  0 &lt;br /&gt;
  3  6  1  0 &lt;br /&gt;
  4  7  1  0 &lt;br /&gt;
  4  8  2  0 &lt;br /&gt;
  5  9  2  0 &lt;br /&gt;
  5 10  1  0 &lt;br /&gt;
  6 11  2  0 &lt;br /&gt;
  7 12  1  0 &lt;br /&gt;
  7 13  2  0 &lt;br /&gt;
  8  9  1  0 &lt;br /&gt;
  9 14  1  0 &lt;br /&gt;
 10 15  1  0 &lt;br /&gt;
 10 16  2  0 &lt;br /&gt;
 11 15  1  0 &lt;br /&gt;
 11 17  1  0 &lt;br /&gt;
 12 18  2  0 &lt;br /&gt;
 13 19  1  0 &lt;br /&gt;
 14 20  2  0 &lt;br /&gt;
 16 20  1  0 &lt;br /&gt;
 18 21  1  0 &lt;br /&gt;
 18 22  1  0 &lt;br /&gt;
 19 21  2  0 &lt;br /&gt;
 20 23  1  0 &lt;br /&gt;
 21 24  1  0 &lt;br /&gt;
 27 28  1  0 &lt;br /&gt;
 28 29  1  1 &lt;br /&gt;
 29 30  1  1 &lt;br /&gt;
 31 30  1  1 &lt;br /&gt;
 31 32  1  0 &lt;br /&gt;
 32 27  1  0 &lt;br /&gt;
 27 33  1  0 &lt;br /&gt;
 32 34  1  0 &lt;br /&gt;
 30 26  1  0 &lt;br /&gt;
 31 35  1  0 &lt;br /&gt;
 25 26  1  0 &lt;br /&gt;
  1 28  1  0 &lt;br /&gt;
M  CHG  1   8   1 &lt;br /&gt;
S  SKP  5 &lt;br /&gt;
ID	FL7AACGL0133 &lt;br /&gt;
FORMULA	C24H23O11 &lt;br /&gt;
EXACTMASS	487.124036578 &lt;br /&gt;
AVERAGEMASS	487.43282 &lt;br /&gt;
SMILES	OCC(O1)C(O)C(O)C(O)C1Oc(c(c(c5)cc(O)c(O)c5)2)c(C=4)c(c3OC(C)4)c(cc(O)c3)[o+1]2 &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>