<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AFL7AACGL0127</id>
		<title>Mol:FL7AACGL0127 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AFL7AACGL0127"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;action=history"/>
		<updated>2026-08-07T03:52:00Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303936&amp;oldid=prev</id>
		<title>Editor at 05:55, 5 December 2012</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303936&amp;oldid=prev"/>
				<updated>2012-12-05T05:55:59Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 05:55, 5 December 2012&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 1:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 1:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;FL7AACGL0127.mol &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;&amp;#160; ChemDraw12051214543D &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;Copyright: ARM project http://www.metabolome.jp/ &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;110119&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0999 V2000 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;110119&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0999 V2000 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; &amp;#160; 2.2909&amp;#160;  -2.1968&amp;#160;  -2.5960 O&amp;#160;  0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; &amp;#160; 2.2909&amp;#160;  -2.1968&amp;#160;  -2.5960 O&amp;#160;  0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 233:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 233:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 1 97&amp;#160; 1&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 1 97&amp;#160; 1&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; CHG&amp;#160; 1&amp;#160;  6&amp;#160;  1 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; CHG&amp;#160; 1&amp;#160;  6&amp;#160;  1 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;del class=&quot;diffchange diffchange-inline&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;9 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	FL7AACGL0127 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	FL7AACGL0127 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;KNApSAcK_ID	 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;NAME	 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;CAS_RN	160253-29-2 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C69H71O35 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C69H71O35 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	1459.377589042 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	1459.377589042 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303933&amp;oldid=prev</id>
		<title>Editor at 05:55, 5 December 2012</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303933&amp;oldid=prev"/>
				<updated>2012-12-05T05:55:08Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;amp;diff=303933&amp;amp;oldid=303924&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303924&amp;oldid=prev</id>
		<title>Editor at 05:44, 5 December 2012</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303924&amp;oldid=prev"/>
				<updated>2012-12-05T05:44:11Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 05:44, 5 December 2012&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 1:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 1:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;FL7AACGL0127.mol &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;&amp;#160; ChemDraw12051214423D &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;Copyright: ARM project http://www.metabolome.jp/ &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;113122&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0999 V2000 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;113122&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0999 V2000 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; &amp;#160; 2.2909&amp;#160;  -2.1968&amp;#160;  -2.5960 O&amp;#160;  0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; &amp;#160; 2.2909&amp;#160;  -2.1968&amp;#160;  -2.5960 O&amp;#160;  0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 239:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 239:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 1100&amp;#160; 1&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 1100&amp;#160; 1&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; CHG&amp;#160; 1&amp;#160;  6&amp;#160;  1 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; CHG&amp;#160; 1&amp;#160;  6&amp;#160;  1 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;del class=&quot;diffchange diffchange-inline&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;9 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	FL7AACGL0127 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	FL7AACGL0127 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;KNApSAcK_ID	 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;NAME	 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;CAS_RN	171204-55-0 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C69H71O38 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C69H71O38 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	1507.3623329079999 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	1507.3623329079999 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303921&amp;oldid=prev</id>
		<title>Editor: Created page with &quot;FL7AACGL0127.mol    ChemDraw12051214423D    113122  0  0  0  0  0  0  0  0999 V2000      2.2909   -2.1968   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0      1.5764   -1.784...&quot;</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:FL7AACGL0127&amp;diff=303921&amp;oldid=prev"/>
				<updated>2012-12-05T05:43:32Z</updated>
		
		<summary type="html">&lt;p&gt;Created page with &amp;quot;FL7AACGL0127.mol    ChemDraw12051214423D    113122  0  0  0  0  0  0  0  0999 V2000      2.2909   -2.1968   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0      1.5764   -1.784...&amp;quot;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;FL7AACGL0127.mol &lt;br /&gt;
  ChemDraw12051214423D &lt;br /&gt;
 &lt;br /&gt;
113122  0  0  0  0  0  0  0  0999 V2000 &lt;br /&gt;
    2.2909   -2.1968   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.5764   -1.7843   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.5764   -0.9593   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.8619   -2.1969   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.2908   -0.5468   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.8619   -0.5468   -2.5960 O   0  3  0  0  0  5  0  0  0  0  0  0 &lt;br /&gt;
    0.1474   -1.7844   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.2909    0.2782   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.0053   -0.9593   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.1474   -0.9593   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.5671   -2.1969   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.0053    0.6907   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.7198   -0.5468   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.5671   -0.5468   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.2816   -1.7844   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.5671   -3.0219   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.7198    0.2782   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.0053    1.5157   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.2816   -0.9594   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.4343    0.6907   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.9961   -0.5469   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.7194    2.5459   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.4338    2.1334   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.2422   -4.1844   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1483    2.5459   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.4339    1.3083   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.2422   -5.0095   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1483    3.3709   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.5913    2.2901   -2.5960 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.5277   -5.4220   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.9567   -5.4220   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8628    3.7834   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.7053    3.6266   -2.5960 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.5277   -6.2470   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.0847   -5.1662   -2.5960 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8628    4.6084   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5773    3.3709   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.8132   -6.6595   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.9707   -6.5027   -2.5960 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5773    5.0209   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2917    3.7834   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.8132   -7.4845   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.0988   -6.2470   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2918    4.6084   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5773    5.8459   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.0987   -7.8970   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.3843   -6.6595   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.0062    5.0209   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.3842   -7.4845   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.0987   -8.7220   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.3303   -7.8970   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.6728    6.5604   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.9583    6.9729   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.9583    7.7979   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.2438    6.5604   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.2438    8.2104   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.4013    8.0537   -2.5960 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.5294    7.7979   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.2438    8.7220   -2.5960 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.8148    8.2105   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.5293    6.9729   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.1003    7.7980   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.8149    6.5604   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.1004    6.9729   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3859    8.2105   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3859    6.5605   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.7823    5.3501   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.3698    4.6357   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.5717    4.8448   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.7785    4.6357   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.1909    5.3501   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.9890    5.1411   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.9883    4.2614   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.5792    5.1366   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.1948    4.6357   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.6693    5.7954   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.0539    2.9615    1.3915 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.0216    2.4933   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.0215    1.7205   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4844    2.2758   -0.1585 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7307    2.4658   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7306    3.2386   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.2680    2.6832   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.6712    2.0967    0.2711 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.2680    3.2951   -0.1585 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.0633    3.4513   -0.1585 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.4433   -3.4287    1.3915 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.0153   -1.5222   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.2425   -1.5223   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.7978   -2.0594   -0.1585 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.9878   -2.8131   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.7606   -2.8132   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.2052   -2.2759   -0.1585 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8707   -0.7495    0.2711 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.8171   -2.2758   -0.1585 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.9733   -3.6071   -0.1585 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4512   -2.9795   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.9417   -2.4497    1.0460 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.0766   -1.8672    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.6902   -2.5364    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.4331   -2.3241    2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.1807   -2.5364    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.5673   -1.8672    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.8242   -2.0795    2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.3157   -1.8859    2.1664 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.1301   -1.5496    2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.3611   -2.0799    2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1495   -2.6007   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1499   -1.7750   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.8640   -3.0132   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.8647   -1.3619   -2.5960 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.8647   -0.5369   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.5792   -1.7744   -2.5960 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0 &lt;br /&gt;
  2  3  1  0 &lt;br /&gt;
  2  4  2  0 &lt;br /&gt;
  3  5  1  0 &lt;br /&gt;
  3  6  2  0 &lt;br /&gt;
  4  7  1  0 &lt;br /&gt;
  5  8  2  0 &lt;br /&gt;
  5  9  1  0 &lt;br /&gt;
  6 10  1  0 &lt;br /&gt;
  7 10  1  0 &lt;br /&gt;
  7 11  2  0 &lt;br /&gt;
  8 12  1  0 &lt;br /&gt;
  9 13  2  0 &lt;br /&gt;
 10 14  2  0 &lt;br /&gt;
 11 15  1  0 &lt;br /&gt;
 11 16  1  0 &lt;br /&gt;
 12 17  2  0 &lt;br /&gt;
 12 18  1  0 &lt;br /&gt;
 13 17  1  0 &lt;br /&gt;
 14 19  1  0 &lt;br /&gt;
 15 19  2  0 &lt;br /&gt;
 17 20  1  0 &lt;br /&gt;
 19 21  1  0 &lt;br /&gt;
 22 23  1  0 &lt;br /&gt;
 23 25  1  0 &lt;br /&gt;
 23 26  2  0 &lt;br /&gt;
 24 27  1  0 &lt;br /&gt;
 25 28  2  0 &lt;br /&gt;
 25 29  1  0 &lt;br /&gt;
 27 30  1  0 &lt;br /&gt;
 27 31  2  0 &lt;br /&gt;
 28 32  1  0 &lt;br /&gt;
 28 33  1  0 &lt;br /&gt;
 30 34  2  0 &lt;br /&gt;
 30 35  1  0 &lt;br /&gt;
 32 36  1  0 &lt;br /&gt;
 32 37  2  0 &lt;br /&gt;
 34 38  1  0 &lt;br /&gt;
 34 39  1  0 &lt;br /&gt;
 36 40  2  0 &lt;br /&gt;
 37 41  1  0 &lt;br /&gt;
 38 42  1  0 &lt;br /&gt;
 38 43  2  0 &lt;br /&gt;
 40 44  1  0 &lt;br /&gt;
 40 45  1  0 &lt;br /&gt;
 41 44  2  0 &lt;br /&gt;
 42 46  2  0 &lt;br /&gt;
 43 47  1  0 &lt;br /&gt;
 44 48  1  0 &lt;br /&gt;
 46 49  1  0 &lt;br /&gt;
 46 50  1  0 &lt;br /&gt;
 47 49  2  0 &lt;br /&gt;
 49 51  1  0 &lt;br /&gt;
 52 53  1  0 &lt;br /&gt;
 53 54  1  0 &lt;br /&gt;
 53 55  2  0 &lt;br /&gt;
 54 56  2  0 &lt;br /&gt;
 54 57  1  0 &lt;br /&gt;
 56 58  1  0 &lt;br /&gt;
 56 59  1  0 &lt;br /&gt;
 58 60  1  0 &lt;br /&gt;
 58 61  2  0 &lt;br /&gt;
 60 62  2  0 &lt;br /&gt;
 61 63  1  0 &lt;br /&gt;
 62 64  1  0 &lt;br /&gt;
 62 65  1  0 &lt;br /&gt;
 63 64  2  0 &lt;br /&gt;
 64 66  1  0 &lt;br /&gt;
 67 68  1  1 &lt;br /&gt;
 69 68  1  1 &lt;br /&gt;
 70 69  1  1 &lt;br /&gt;
 70 71  1  0 &lt;br /&gt;
 71 72  1  0 &lt;br /&gt;
 72 67  1  0 &lt;br /&gt;
 69 73  1  0 &lt;br /&gt;
 67 74  1  0 &lt;br /&gt;
 68 75  1  0 &lt;br /&gt;
 72 76  1  0 &lt;br /&gt;
 48 70  1  0 &lt;br /&gt;
 52 76  1  0 &lt;br /&gt;
 78 79  1  0 &lt;br /&gt;
 79 80  1  1 &lt;br /&gt;
 80 81  1  1 &lt;br /&gt;
 82 81  1  1 &lt;br /&gt;
 82 83  1  0 &lt;br /&gt;
 83 78  1  0 &lt;br /&gt;
 78 84  1  0 &lt;br /&gt;
 83 85  1  0 &lt;br /&gt;
 81 77  1  0 &lt;br /&gt;
 82 86  1  0 &lt;br /&gt;
 22 77  1  0 &lt;br /&gt;
 18 79  1  0 &lt;br /&gt;
 88 89  1  0 &lt;br /&gt;
 89 90  1  1 &lt;br /&gt;
 90 91  1  1 &lt;br /&gt;
 92 91  1  1 &lt;br /&gt;
 92 93  1  0 &lt;br /&gt;
 93 88  1  0 &lt;br /&gt;
 88 94  1  0 &lt;br /&gt;
 93 95  1  0 &lt;br /&gt;
 91 87  1  0 &lt;br /&gt;
 92 96  1  0 &lt;br /&gt;
 21 89  1  0 &lt;br /&gt;
 24 87  1  0 &lt;br /&gt;
 99100  1  0 &lt;br /&gt;
100101  1  1 &lt;br /&gt;
101102  1  1 &lt;br /&gt;
103102  1  1 &lt;br /&gt;
103104  1  0 &lt;br /&gt;
104 99  1  0 &lt;br /&gt;
 99105  1  0 &lt;br /&gt;
104106  1  0 &lt;br /&gt;
102 98  1  0 &lt;br /&gt;
103107  1  0 &lt;br /&gt;
 97 98  1  0 &lt;br /&gt;
108109  1  0 &lt;br /&gt;
108110  2  0 &lt;br /&gt;
109111  1  0 &lt;br /&gt;
111112  1  0 &lt;br /&gt;
111113  2  0 &lt;br /&gt;
 97108  1  0 &lt;br /&gt;
  1100  1  0 &lt;br /&gt;
M  CHG  1   6   1 &lt;br /&gt;
S  SKP  5 &lt;br /&gt;
ID	FL7AACGL0127 &lt;br /&gt;
FORMULA	C69H71O38 &lt;br /&gt;
EXACTMASS	1507.3623329079999 &lt;br /&gt;
AVERAGEMASS	1508.27924 &lt;br /&gt;
SMILES	c(c1)c(O)c(O)cc(C(=C(C(=O)OCC(O2)C(O)C(C(C(Oc(c%10)c(O)cc(c%10)C(=C([H])C(=O)OCC(O3)C(O)C(C(O)C(Oc(c(O)4)cc(c(c8OC(C9O)OC(COC(=O)CC(O)=O)C(O)C9O)[o+1]c(c5)c(c8)c(O)cc5OC(O6)C(O)C(O)C(C(COC(C(=C([H])c(c7)cc(c(c7)O)O)[H])=O)6)O)cc4)3)O)[H])2)O)O)[H])[H])1 &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>