<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMAXS3AKa002</id>
		<title>Mol:BMAXS3AKa002 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMAXS3AKa002"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;action=history"/>
		<updated>2026-09-16T17:53:28Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176284&amp;oldid=prev</id>
		<title>Editor at 02:49, 16 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176284&amp;oldid=prev"/>
				<updated>2010-06-16T02:49:12Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 02:49, 16 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 113:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 113:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 7 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 7 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMAXS3AKa002 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMAXS3AKa002 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	S- [2- [3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3- dimethylbutanoyl] amino] propanoylamino] ethyl] 3-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;aminopropanethioate &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	S- [2- [3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3- dimethylbutanoyl] amino] propanoylamino] ethyl] 3-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;aminopropanethioic acid &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;CAS_RN	 6875-55-4 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;CAS_RN	 6875-55-4 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C24H41N8O17P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C24H41N8O17P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176283&amp;oldid=prev</id>
		<title>Editor at 08:13, 11 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176283&amp;oldid=prev"/>
				<updated>2010-06-11T08:13:47Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 08:13, 11 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 113:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 113:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 7 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 7 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMAXS3AKa002 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMAXS3AKa002 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;beta&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;Alanyl&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;CoA &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;S&lt;/ins&gt;- &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;[2&lt;/ins&gt;- &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;[3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3- dimethylbutanoyl] amino] propanoylamino] ethyl] 3-aminopropanethioate &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;CAS_RN	 6875-55-4 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C24H41N8O17P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C24H41N8O17P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	838.1523 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	838.1523 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176282&amp;oldid=prev</id>
		<title>Editor at 00:00, 14 March 2009</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176282&amp;oldid=prev"/>
				<updated>2009-03-14T00:00:00Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;amp;diff=176282&amp;amp;oldid=176281&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176281&amp;oldid=prev</id>
		<title>Editor at 00:00, 7 October 2008</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMAXS3AKa002&amp;diff=176281&amp;oldid=prev"/>
				<updated>2008-10-07T00:00:00Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;&amp;lt;pre&amp;gt;&lt;br /&gt;
&lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/&lt;br /&gt;
 53 55  0  0  1  0  0  0  0  0999 V2000&lt;br /&gt;
    4.6254   -3.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    3.6473   -3.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    2.9781   -4.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    2.0000   -4.1621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    4.9344   -4.7859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.9825   -2.8049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.1165   -2.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.1165   -1.3049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.9825   -0.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.8486   -1.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.8486   -2.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   23.5917   -0.6358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   23.1850    0.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.1904    0.1733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   23.7146   -2.8049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.5213    0.9164    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.7292    1.8946    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.8632    2.3946    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.1201    1.7254    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   19.1419    1.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.6428    2.3013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.7587    3.3891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.5268    0.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   18.4728    1.1902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.5677    3.9769    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.1555    3.1678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.9799    4.7859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.3767    4.5646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   17.4946    1.3981    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   17.2867    0.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   17.7025    2.3762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   16.5165    1.6060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   15.8474    0.8629    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   16.5905    0.1937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   15.1042    1.5320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   15.1782    0.1197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   14.2001    0.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   13.5309   -0.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   14.2741   -1.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   12.7878    0.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   12.8618   -1.1587    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   11.8837   -0.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   11.2145   -1.6939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   10.2364   -1.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    9.5673   -2.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    8.5891   -2.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    7.9200   -2.7644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    6.9418   -2.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    6.2727   -3.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    5.2946   -3.0917    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   13.1708   -2.1097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   11.5747    0.0003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    8.2801   -1.0702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
  6 11  2  0  0  0  0&lt;br /&gt;
  6  7  1  0  0  0  0&lt;br /&gt;
  7  8  2  0  0  0  0&lt;br /&gt;
  8  9  1  0  0  0  0&lt;br /&gt;
 10 11  1  0  0  0  0&lt;br /&gt;
 10  9  2  0  0  0  0&lt;br /&gt;
 14 13  1  0  0  0  0&lt;br /&gt;
 13 12  2  0  0  0  0&lt;br /&gt;
 12 10  1  0  0  0  0&lt;br /&gt;
  9 14  1  0  0  0  0&lt;br /&gt;
 11 15  1  0  0  0  0&lt;br /&gt;
 19 23  1  6  0  0  0&lt;br /&gt;
 18 19  1  0  0  0  0&lt;br /&gt;
 16 23  1  6  0  0  0&lt;br /&gt;
 18 17  1  0  0  0  0&lt;br /&gt;
 16 17  1  0  0  0  0&lt;br /&gt;
 19 20  1  0  0  0  0&lt;br /&gt;
 20 24  1  0  0  0  0&lt;br /&gt;
 16 14  1  0  0  0  0&lt;br /&gt;
 24 29  1  0  0  0  0&lt;br /&gt;
 29 31  1  0  0  0  0&lt;br /&gt;
 29 30  2  0  0  0  0&lt;br /&gt;
 29 32  1  0  0  0  0&lt;br /&gt;
 36 33  1  0  0  0  0&lt;br /&gt;
 33 34  2  0  0  0  0&lt;br /&gt;
 33 35  1  0  0  0  0&lt;br /&gt;
 36 37  1  0  0  0  0&lt;br /&gt;
 33 32  1  0  0  0  0&lt;br /&gt;
 37 38  1  0  0  0  0&lt;br /&gt;
 38 41  1  0  0  0  0&lt;br /&gt;
 38 39  1  0  0  0  0&lt;br /&gt;
 38 40  1  0  0  0  0&lt;br /&gt;
 41 42  1  0  0  0  0&lt;br /&gt;
 41 51  1  1  0  0  0&lt;br /&gt;
 42 52  2  0  0  0  0&lt;br /&gt;
 42 43  1  0  0  0  0&lt;br /&gt;
 43 44  1  0  0  0  0&lt;br /&gt;
 44 45  1  0  0  0  0&lt;br /&gt;
 45 46  1  0  0  0  0&lt;br /&gt;
 46 47  1  0  0  0  0&lt;br /&gt;
 46 53  2  0  0  0  0&lt;br /&gt;
 47 48  1  0  0  0  0&lt;br /&gt;
 48 49  1  0  0  0  0&lt;br /&gt;
 49 50  1  0  0  0  0&lt;br /&gt;
 17 21  1  1  0  0  0&lt;br /&gt;
 18 22  1  1  0  0  0&lt;br /&gt;
 26 25  1  0  0  0  0&lt;br /&gt;
 25 27  1  0  0  0  0&lt;br /&gt;
 25 28  2  0  0  0  0&lt;br /&gt;
 22 25  1  0  0  0  0&lt;br /&gt;
  4  3  1  0  0  0  0&lt;br /&gt;
  3  2  1  0  0  0  0&lt;br /&gt;
  1 50  1  0  0  0  0&lt;br /&gt;
  1  5  2  0  0  0  0&lt;br /&gt;
  2  1  1  0  0  0  0&lt;br /&gt;
S  SKP  7&lt;br /&gt;
ID	BMAXS3AKa002&lt;br /&gt;
NAME	beta-Alanyl-CoA&lt;br /&gt;
FORMULA	C24H41N8O17P3S&lt;br /&gt;
EXACTMASS	838.1523&lt;br /&gt;
AVERAGEMASS	838.6133&lt;br /&gt;
SMILES	n(c3N)cnc(c32)n(cn2)[C@@H]([C@@H]1O)O[C@@H]([C@H]1OP(O)(O)=O)COP(OP(O)(=O)OCC([C@@H](O)C(NCCC(=O)NCCSC(=O)CCN)=O)(C)C)(O)=O&lt;br /&gt;
KEGG	http://www.genome.jp/dbget-bin/www_bget?compound+C02335&lt;br /&gt;
M  END&lt;br /&gt;
&amp;lt;/pre&amp;gt;&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>